C10H9F3O — CID 105454124
4,4-difluoro-4-(3-fluorophenyl)butan-2-one (PubChem CID 105454124) has the molecular formula C10H9F3O and a molecular weight of 202.18 g/mol. Its IUPAC name is 4,4-difluoro-4-(3-fluorophenyl)butan-2-one.
| Compound Name | 4,4-difluoro-4-(3-fluorophenyl)butan-2-one |
|---|---|
| PubChem CID | 105454124 |
| Molecular Formula | C10H9F3O |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 4,4-difluoro-4-(3-fluorophenyl)butan-2-one |
| SMILES | CC(=O)CC(F)(F)c1cccc(F)c1 |
| InChI | InChI=1S/C10H9F3O/c1-7(14)6-10(12,13)8-3-2-4-9(11)5-8/h2-5H,6H2,1H3 |
| InChIKey | RYONYWJQKLXYCS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |