C11H12F2O — CID 105451355
4,4-difluoro-4-(3-methylphenyl)butan-2-one (PubChem CID 105451355) has the molecular formula C11H12F2O and a molecular weight of 198.21 g/mol. Its IUPAC name is 4,4-difluoro-4-(3-methylphenyl)butan-2-one.
| Compound Name | 4,4-difluoro-4-(3-methylphenyl)butan-2-one |
|---|---|
| PubChem CID | 105451355 |
| Molecular Formula | C11H12F2O |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4,4-difluoro-4-(3-methylphenyl)butan-2-one |
| SMILES | CC(=O)CC(F)(F)c1cccc(C)c1 |
| InChI | InChI=1S/C11H12F2O/c1-8-4-3-5-10(6-8)11(12,13)7-9(2)14/h3-6H,7H2,1-2H3 |
| InChIKey | WMYHVWLKQKHMIH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |