C17H14F6 — CID 163492269
1-[1,1,2,2,3,3-hexafluoro-3-(3-methylphenyl)propyl]-3-methylbenzene (PubChem CID 163492269) has the molecular formula C17H14F6 and a molecular weight of 332.29 g/mol. Its IUPAC name is 1-[1,1,2,2,3,3-hexafluoro-3-(3-methylphenyl)propyl]-3-methylbenzene.
| Compound Name | 1-[1,1,2,2,3,3-hexafluoro-3-(3-methylphenyl)propyl]-3-methylbenzene |
|---|---|
| PubChem CID | 163492269 |
| Molecular Formula | C17H14F6 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-[1,1,2,2,3,3-hexafluoro-3-(3-methylphenyl)propyl]-3-methylbenzene |
| SMILES | Cc1cccc(C(F)(F)C(F)(F)C(F)(F)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C17H14F6/c1-11-5-3-7-13(9-11)15(18,19)17(22,23)16(20,21)14-8-4-6-12(2)10-14/h3-10H,1-2H3 |
| InChIKey | CNRIZSDDEVTRAE-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|