C15H19F3O2 — CID 63541225
2-propyl-2-[3-(trifluoromethyl)phenyl]pentanoic acid (PubChem CID 63541225) has the molecular formula C15H19F3O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-propyl-2-[3-(trifluoromethyl)phenyl]pentanoic acid.
| Compound Name | 2-propyl-2-[3-(trifluoromethyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 63541225 |
| Molecular Formula | C15H19F3O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-propyl-2-[3-(trifluoromethyl)phenyl]pentanoic acid |
| SMILES | CCCC(CCC)(C(=O)O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3O2/c1-3-8-14(9-4-2,13(19)20)11-6-5-7-12(10-11)15(16,17)18/h5-7,10H,3-4,8-9H2,1-2H3,(H,19,20) |
| InChIKey | IXTQFQKEASHYTP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |