C12H13B2F3O — CID 145487345
CID 145487345 (PubChem CID 145487345) has the molecular formula C12H13B2F3O and a molecular weight of 251.85 g/mol.
| Compound Name | CID 145487345 |
|---|---|
| PubChem CID | 145487345 |
| Molecular Formula | C12H13B2F3O |
| Molecular Weight | 251.85 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | — |
| SMILES | [B]C([B])(CO)C(C)(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13B2F3O/c1-10(2,11(13,14)7-18)8-4-3-5-9(6-8)12(15,16)17/h3-6,18H,7H2,1-2H3 |
| InChIKey | PZQOHCZDNNBFNJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.85 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|