C16H17F3O — CID 116536006
6,6,6-trifluoro-2-naphthalen-2-ylhexan-2-ol (PubChem CID 116536006) has the molecular formula C16H17F3O and a molecular weight of 282.31 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-naphthalen-2-ylhexan-2-ol.
| Compound Name | 6,6,6-trifluoro-2-naphthalen-2-ylhexan-2-ol |
|---|---|
| PubChem CID | 116536006 |
| Molecular Formula | C16H17F3O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 6,6,6-trifluoro-2-naphthalen-2-ylhexan-2-ol |
| SMILES | CC(O)(CCCC(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H17F3O/c1-15(20,9-4-10-16(17,18)19)14-8-7-12-5-2-3-6-13(12)11-14/h2-3,5-8,11,20H,4,9-10H2,1H3 |
| InChIKey | RMBFGNRNVAIZHZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |