C11H13F4NO — CID 116535810
6,6,6-trifluoro-2-(3-fluoro-4-pyridinyl)hexan-2-ol (PubChem CID 116535810) has the molecular formula C11H13F4NO and a molecular weight of 251.22 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-(3-fluoro-4-pyridinyl)hexan-2-ol.
| Compound Name | 6,6,6-trifluoro-2-(3-fluoro-4-pyridinyl)hexan-2-ol |
|---|---|
| PubChem CID | 116535810 |
| Molecular Formula | C11H13F4NO |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 6,6,6-trifluoro-2-(3-fluoro-4-pyridinyl)hexan-2-ol |
| SMILES | CC(O)(CCCC(F)(F)F)c1ccncc1F |
| InChI | InChI=1S/C11H13F4NO/c1-10(17,4-2-5-11(13,14)15)8-3-6-16-7-9(8)12/h3,6-7,17H,2,4-5H2,1H3 |
| InChIKey | FXEYDBXYMKSYJA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |