C12H17F3N2O — CID 116535966
2-(2-amino-5-methyl-3-pyridinyl)-6,6,6-trifluorohexan-2-ol (PubChem CID 116535966) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-(2-amino-5-methyl-3-pyridinyl)-6,6,6-trifluorohexan-2-ol.
| Compound Name | 2-(2-amino-5-methyl-3-pyridinyl)-6,6,6-trifluorohexan-2-ol |
|---|---|
| PubChem CID | 116535966 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-(2-amino-5-methyl-3-pyridinyl)-6,6,6-trifluorohexan-2-ol |
| SMILES | Cc1cnc(N)c(C(C)(O)CCCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H17F3N2O/c1-8-6-9(10(16)17-7-8)11(2,18)4-3-5-12(13,14)15/h6-7,18H,3-5H2,1-2H3,(H2,16,17) |
| InChIKey | NEMFOZXQFBPODC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |