C11H14F3NO2S — CID 115519811
4-methyl-2-(4,4,4-trifluorobutylsulfonyl)aniline (PubChem CID 115519811) has the molecular formula C11H14F3NO2S and a molecular weight of 281.30 g/mol. Its IUPAC name is 4-methyl-2-(4,4,4-trifluorobutylsulfonyl)aniline.
| Compound Name | 4-methyl-2-(4,4,4-trifluorobutylsulfonyl)aniline |
|---|---|
| PubChem CID | 115519811 |
| Molecular Formula | C11H14F3NO2S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-methyl-2-(4,4,4-trifluorobutylsulfonyl)aniline |
| SMILES | Cc1ccc(N)c(S(=O)(=O)CCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3NO2S/c1-8-3-4-9(15)10(7-8)18(16,17)6-2-5-11(12,13)14/h3-4,7H,2,5-6,15H2,1H3 |
| InChIKey | HDYQHRYLYXVILM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|