C9H9ClF3NO2S — CID 81180863
4-chloro-2-(3,3,3-trifluoropropylsulfonyl)aniline (PubChem CID 81180863) has the molecular formula C9H9ClF3NO2S and a molecular weight of 287.69 g/mol. Its IUPAC name is 4-chloro-2-(3,3,3-trifluoropropylsulfonyl)aniline.
| Compound Name | 4-chloro-2-(3,3,3-trifluoropropylsulfonyl)aniline |
|---|---|
| PubChem CID | 81180863 |
| Molecular Formula | C9H9ClF3NO2S |
| Molecular Weight | 287.69 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 4-chloro-2-(3,3,3-trifluoropropylsulfonyl)aniline |
| SMILES | Nc1ccc(Cl)cc1S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C9H9ClF3NO2S/c10-6-1-2-7(14)8(5-6)17(15,16)4-3-9(11,12)13/h1-2,5H,3-4,14H2 |
| InChIKey | MRNMLSGIUAASDI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|