C12H18ClNO4S2 — CID 106735680
2-(2-tert-butylsulfonylethylsulfonyl)-4-chloroaniline (PubChem CID 106735680) has the molecular formula C12H18ClNO4S2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 2-(2-tert-butylsulfonylethylsulfonyl)-4-chloroaniline.
| Compound Name | 2-(2-tert-butylsulfonylethylsulfonyl)-4-chloroaniline |
|---|---|
| PubChem CID | 106735680 |
| Molecular Formula | C12H18ClNO4S2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 2-(2-tert-butylsulfonylethylsulfonyl)-4-chloroaniline |
| SMILES | CC(C)(C)S(=O)(=O)CCS(=O)(=O)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C12H18ClNO4S2/c1-12(2,3)20(17,18)7-6-19(15,16)11-8-9(13)4-5-10(11)14/h4-5,8H,6-7,14H2,1-3H3 |
| InChIKey | JSVVVYWPXBSXFQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|