C13H18ClNO3S — CID 116525462
4-chloro-2-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]aniline (PubChem CID 116525462) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is 4-chloro-2-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]aniline.
| Compound Name | 4-chloro-2-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]aniline |
|---|---|
| PubChem CID | 116525462 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-chloro-2-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]aniline |
| SMILES | CC1(C)CCC(CS(=O)(=O)c2cc(Cl)ccc2N)O1 |
| InChI | InChI=1S/C13H18ClNO3S/c1-13(2)6-5-10(18-13)8-19(16,17)12-7-9(14)3-4-11(12)15/h3-4,7,10H,5-6,8,15H2,1-2H3 |
| InChIKey | GYINTQAESOESNT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|