C14H17FO5S — CID 116521915
3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-4-fluorobenzoic acid (PubChem CID 116521915) has the molecular formula C14H17FO5S and a molecular weight of 316.35 g/mol. Its IUPAC name is 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-4-fluorobenzoic acid.
| Compound Name | 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 116521915 |
| Molecular Formula | C14H17FO5S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]-4-fluorobenzoic acid |
| SMILES | CC1(C)CCC(CS(=O)(=O)c2cc(C(=O)O)ccc2F)O1 |
| InChI | InChI=1S/C14H17FO5S/c1-14(2)6-5-10(20-14)8-21(18,19)12-7-9(13(16)17)3-4-11(12)15/h3-4,7,10H,5-6,8H2,1-2H3,(H,16,17) |
| InChIKey | XFVORJMZPJFRAB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |