C11H20O5S — CID 105354346
2-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]butanoic acid (PubChem CID 105354346) has the molecular formula C11H20O5S and a molecular weight of 264.34 g/mol. Its IUPAC name is 2-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]butanoic acid.
| Compound Name | 2-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]butanoic acid |
|---|---|
| PubChem CID | 105354346 |
| Molecular Formula | C11H20O5S |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-[(5,5-dimethyloxolan-2-yl)methylsulfonyl]butanoic acid |
| SMILES | CCC(C(=O)O)S(=O)(=O)CC1CCC(C)(C)O1 |
| InChI | InChI=1S/C11H20O5S/c1-4-9(10(12)13)17(14,15)7-8-5-6-11(2,3)16-8/h8-9H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | CFRFUBGSZJGTAS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |