C13H10Cl3NO2S — CID 81180514
4-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]aniline (PubChem CID 81180514) has the molecular formula C13H10Cl3NO2S and a molecular weight of 350.65 g/mol. Its IUPAC name is 4-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]aniline.
| Compound Name | 4-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]aniline |
|---|---|
| PubChem CID | 81180514 |
| Molecular Formula | C13H10Cl3NO2S |
| Molecular Weight | 350.65 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 4-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]aniline |
| SMILES | Nc1ccc(Cl)cc1S(=O)(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H10Cl3NO2S/c14-8-4-5-12(17)13(6-8)20(18,19)7-9-10(15)2-1-3-11(9)16/h1-6H,7,17H2 |
| InChIKey | FOBGPFIFMZIBQI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.65 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|