C10H12F3NO3S — CID 106706719
4-methyl-2-(2,2,2-trifluoroethoxymethylsulfonyl)aniline (PubChem CID 106706719) has the molecular formula C10H12F3NO3S and a molecular weight of 283.27 g/mol. Its IUPAC name is 4-methyl-2-(2,2,2-trifluoroethoxymethylsulfonyl)aniline.
| Compound Name | 4-methyl-2-(2,2,2-trifluoroethoxymethylsulfonyl)aniline |
|---|---|
| PubChem CID | 106706719 |
| Molecular Formula | C10H12F3NO3S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4-methyl-2-(2,2,2-trifluoroethoxymethylsulfonyl)aniline |
| SMILES | Cc1ccc(N)c(S(=O)(=O)COCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3NO3S/c1-7-2-3-8(14)9(4-7)18(15,16)6-17-5-10(11,12)13/h2-4H,5-6,14H2,1H3 |
| InChIKey | PXJIDCLDQSLKHC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|