C16H26O3 — CID 116861537
4-(3-tert-butyl-4-methoxyphenyl)pentane-1,4-diol (PubChem CID 116861537) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-(3-tert-butyl-4-methoxyphenyl)pentane-1,4-diol.
| Compound Name | 4-(3-tert-butyl-4-methoxyphenyl)pentane-1,4-diol |
|---|---|
| PubChem CID | 116861537 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 4-(3-tert-butyl-4-methoxyphenyl)pentane-1,4-diol |
| SMILES | COc1ccc(C(C)(O)CCCO)cc1C(C)(C)C |
| InChI | InChI=1S/C16H26O3/c1-15(2,3)13-11-12(7-8-14(13)19-5)16(4,18)9-6-10-17/h7-8,11,17-18H,6,9-10H2,1-5H3 |
| InChIKey | DJVUNPBJHIOCPT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |