C11H10F6O3 — CID 118535888
2-(3,4-dimethoxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118535888) has the molecular formula C11H10F6O3 and a molecular weight of 304.19 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118535888 |
| Molecular Formula | C11H10F6O3 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | COc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C11H10F6O3/c1-19-7-4-3-6(5-8(7)20-2)9(18,10(12,13)14)11(15,16)17/h3-5,18H,1-2H3 |
| InChIKey | XVPCYMBCRWLNEL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |