C11H11F2NO2 — CID 116840688
3-(3,4-dimethoxyphenyl)-3,3-difluoropropanenitrile (PubChem CID 116840688) has the molecular formula C11H11F2NO2 and a molecular weight of 227.21 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-3,3-difluoropropanenitrile.
| Compound Name | 3-(3,4-dimethoxyphenyl)-3,3-difluoropropanenitrile |
|---|---|
| PubChem CID | 116840688 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-3,3-difluoropropanenitrile |
| SMILES | COc1ccc(C(F)(F)CC#N)cc1OC |
| InChI | InChI=1S/C11H11F2NO2/c1-15-9-4-3-8(7-10(9)16-2)11(12,13)5-6-14/h3-4,7H,5H2,1-2H3 |
| InChIKey | RGVRGANISUEYAS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |