C16H18O3 — CID 55116125
1-(3,4-dimethoxyphenyl)-1-phenylethanol (PubChem CID 55116125) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-1-phenylethanol.
| Compound Name | 1-(3,4-dimethoxyphenyl)-1-phenylethanol |
|---|---|
| PubChem CID | 55116125 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-1-phenylethanol |
| SMILES | COc1ccc(C(C)(O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C16H18O3/c1-16(17,12-7-5-4-6-8-12)13-9-10-14(18-2)15(11-13)19-3/h4-11,17H,1-3H3 |
| InChIKey | SKWLIJBASNCZMB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |