C14H16N2O — CID 124563063
(1S)-1-(3,4-diaminophenyl)-1-phenylethanol (PubChem CID 124563063) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is (1S)-1-(3,4-diaminophenyl)-1-phenylethanol.
| Compound Name | (1S)-1-(3,4-diaminophenyl)-1-phenylethanol |
|---|---|
| PubChem CID | 124563063 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (1S)-1-(3,4-diaminophenyl)-1-phenylethanol |
| SMILES | C[C@](O)(c1ccccc1)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C14H16N2O/c1-14(17,10-5-3-2-4-6-10)11-7-8-12(15)13(16)9-11/h2-9,17H,15-16H2,1H3/t14-/m0/s1 |
| InChIKey | HIHLDYIWRYOYCT-AWEZNQCLSA-N |
| XLogP | 2.11 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|