C17H18O2 — CID 114520749
1-(3-cyclopropyloxyphenyl)-1-phenylethanol (PubChem CID 114520749) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(3-cyclopropyloxyphenyl)-1-phenylethanol.
| Compound Name | 1-(3-cyclopropyloxyphenyl)-1-phenylethanol |
|---|---|
| PubChem CID | 114520749 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-(3-cyclopropyloxyphenyl)-1-phenylethanol |
| SMILES | CC(O)(c1ccccc1)c1cccc(OC2CC2)c1 |
| InChI | InChI=1S/C17H18O2/c1-17(18,13-6-3-2-4-7-13)14-8-5-9-16(12-14)19-15-10-11-15/h2-9,12,15,18H,10-11H2,1H3 |
| InChIKey | TWBUHJDOIPPVNW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |