C13H19NO2 — CID 114523428
4-amino-2-(3-cyclopropyloxyphenyl)butan-2-ol (PubChem CID 114523428) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-amino-2-(3-cyclopropyloxyphenyl)butan-2-ol.
| Compound Name | 4-amino-2-(3-cyclopropyloxyphenyl)butan-2-ol |
|---|---|
| PubChem CID | 114523428 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 4-amino-2-(3-cyclopropyloxyphenyl)butan-2-ol |
| SMILES | CC(O)(CCN)c1cccc(OC2CC2)c1 |
| InChI | InChI=1S/C13H19NO2/c1-13(15,7-8-14)10-3-2-4-12(9-10)16-11-5-6-11/h2-4,9,11,15H,5-8,14H2,1H3 |
| InChIKey | BODBZMSCLFZCAV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |