C19H22O2 — CID 114518706
1-(4-cyclopropyloxyphenyl)-1-(3,5-dimethylphenyl)ethanol (PubChem CID 114518706) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-(4-cyclopropyloxyphenyl)-1-(3,5-dimethylphenyl)ethanol.
| Compound Name | 1-(4-cyclopropyloxyphenyl)-1-(3,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 114518706 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1-(4-cyclopropyloxyphenyl)-1-(3,5-dimethylphenyl)ethanol |
| SMILES | Cc1cc(C)cc(C(C)(O)c2ccc(OC3CC3)cc2)c1 |
| InChI | InChI=1S/C19H22O2/c1-13-10-14(2)12-16(11-13)19(3,20)15-4-6-17(7-5-15)21-18-8-9-18/h4-7,10-12,18,20H,8-9H2,1-3H3 |
| InChIKey | ZUSFTXITJYWJQR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |