C16H26O2 — CID 114209720
2-(4-methoxyphenyl)-6,6-dimethylheptan-2-ol (PubChem CID 114209720) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6,6-dimethylheptan-2-ol.
| Compound Name | 2-(4-methoxyphenyl)-6,6-dimethylheptan-2-ol |
|---|---|
| PubChem CID | 114209720 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2-(4-methoxyphenyl)-6,6-dimethylheptan-2-ol |
| SMILES | COc1ccc(C(C)(O)CCCC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26O2/c1-15(2,3)11-6-12-16(4,17)13-7-9-14(18-5)10-8-13/h7-10,17H,6,11-12H2,1-5H3 |
| InChIKey | QRHYMWXXRDMXAF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |