About (2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile
(2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile (PubChem CID 91810608) has the molecular formula C16H24N2O2
and a molecular weight of 276.38 g/mol. Its IUPAC name is (2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile.
Molecular Properties
| Compound Name | (2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile |
| PubChem CID | 91810608 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile |
| SMILES | COc1ccc([C@](C#N)(CCCN)C(C)C)cc1OC |
| InChI | InChI=1S/C16H24N2O2/c1-12(2)16(11-18,8-5-9-17)13-6-7-14(19-3)15(10-13)20-4/h6-7,10,12H,5,8-9,17H2,1-4H3/t16-/m0/s1 |
| InChIKey | UCWOSFAANAZHKR-INIZCTEOSA-N |
| XLogP | 2.86 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile?
The IUPAC name of (2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile (CID 91810608) is (2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile.
What is the SMILES notation for (2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile?
The canonical SMILES for (2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile is COc1ccc([C@](C#N)(CCCN)C(C)C)cc1OC.
What is the InChIKey of (2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile?
The InChIKey is UCWOSFAANAZHKR-INIZCTEOSA-N. The full InChI is InChI=1S/C16H24N2O2/c1-12(2)16(11-18,8-5-9-17)13-6-7-14(19-3)15(10-13)20-4/h6-7,10,12H,5,8-9,17H2,1-4H3/t16-/m0/s1.
What are the key properties of (2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile?
(2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile has a molecular weight of 276.38 g/mol, XLogP of 2.86, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-amino-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile is sourced from PubChem (CID 91810608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).