C25H42N2O2 — CID 70066338
2-(3,4-dimethoxyphenyl)-5-(nonylamino)-2-propan-2-ylpentanenitrile (PubChem CID 70066338) has the molecular formula C25H42N2O2 and a molecular weight of 402.62 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-(nonylamino)-2-propan-2-ylpentanenitrile.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-(nonylamino)-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 70066338 |
| Molecular Formula | C25H42N2O2 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.32 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-(nonylamino)-2-propan-2-ylpentanenitrile |
| SMILES | CCCCCCCCCNCCCC(C#N)(c1ccc(OC)c(OC)c1)C(C)C |
| InChI | InChI=1S/C25H42N2O2/c1-6-7-8-9-10-11-12-17-27-18-13-16-25(20-26,21(2)3)22-14-15-23(28-4)24(19-22)29-5/h14-15,19,21,27H,6-13,16-18H2,1-5H3 |
| InChIKey | VSFSNMPVCGXJOQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|