C18H27NO3 — CID 145475494
2-(3,4-dimethoxyphenyl)-5-oxo-2-propan-2-ylpentanenitrile;ethane (PubChem CID 145475494) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-oxo-2-propan-2-ylpentanenitrile;ethane.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-oxo-2-propan-2-ylpentanenitrile;ethane |
|---|---|
| PubChem CID | 145475494 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-oxo-2-propan-2-ylpentanenitrile;ethane |
| SMILES | CC.COc1ccc(C(C#N)(CCC=O)C(C)C)cc1OC |
| InChI | InChI=1S/C16H21NO3.C2H6/c1-12(2)16(11-17,8-5-9-18)13-6-7-14(19-3)15(10-13)20-4;1-2/h6-7,9-10,12H,5,8H2,1-4H3;1-2H3 |
| InChIKey | OXNJNIKNPPHMKS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|