C28H41N2O4+ — CID 10097659
[4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-[2-(3,4-dimethoxyphenyl)ethyl]-dimethylazanium (PubChem CID 10097659) has the molecular formula C28H41N2O4+ and a molecular weight of 469.65 g/mol. Its IUPAC name is [4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-[2-(3,4-dimethoxyphenyl)ethyl]-dimethylazanium.
| Compound Name | [4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-[2-(3,4-dimethoxyphenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 10097659 |
| Molecular Formula | C28H41N2O4+ |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | [4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-[2-(3,4-dimethoxyphenyl)ethyl]-dimethylazanium |
| SMILES | COc1ccc(CC[N+](C)(C)CCCC(C#N)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC |
| InChI | InChI=1S/C28H41N2O4/c1-21(2)28(20-29,23-11-13-25(32-6)27(19-23)34-8)15-9-16-30(3,4)17-14-22-10-12-24(31-5)26(18-22)33-7/h10-13,18-19,21H,9,14-17H2,1-8H3/q+1 |
| InChIKey | GRPOKKQWTLBPOM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|