C27H40N2O8S — CID 25032907
(2R)-2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentanenitrile;sulfuric acid (PubChem CID 25032907) has the molecular formula C27H40N2O8S and a molecular weight of 552.69 g/mol. Its IUPAC name is (2R)-2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentanenitrile;sulfuric acid.
| Compound Name | (2R)-2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentanenitrile;sulfuric acid |
|---|---|
| PubChem CID | 25032907 |
| Molecular Formula | C27H40N2O8S |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | (2R)-2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentanenitrile;sulfuric acid |
| SMILES | COc1ccc(CCN(C)CCC[C@](C#N)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC.O=S(=O)(O)O |
| InChI | InChI=1S/C27H38N2O4.H2O4S/c1-20(2)27(19-28,22-10-12-24(31-5)26(18-22)33-7)14-8-15-29(3)16-13-21-9-11-23(30-4)25(17-21)32-6;1-5(2,3)4/h9-12,17-18,20H,8,13-16H2,1-7H3;(H2,1,2,3,4)/t27-;/m1./s1 |
| InChIKey | QXFQWDLVAQDTRS-HZPIKELBSA-N |
| XLogP | 4.44 |
| TPSA | 138.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|