C28H39NO4 — CID 176727000
4-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-propan-2-ylhex-5-yn-1-amine (PubChem CID 176727000) has the molecular formula C28H39NO4 and a molecular weight of 453.62 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-propan-2-ylhex-5-yn-1-amine.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-propan-2-ylhex-5-yn-1-amine |
|---|---|
| PubChem CID | 176727000 |
| Molecular Formula | C28H39NO4 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-propan-2-ylhex-5-yn-1-amine |
| SMILES | C#CC(CCCN(C)CCc1ccc(OC)c(OC)c1)(c1ccc(OC)c(OC)c1)C(C)C |
| InChI | InChI=1S/C28H39NO4/c1-9-28(21(2)3,23-12-14-25(31-6)27(20-23)33-8)16-10-17-29(4)18-15-22-11-13-24(30-5)26(19-22)32-7/h1,11-14,19-21H,10,15-18H2,2-8H3 |
| InChIKey | IIVSJMAOFZSAEY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|