C29H48Cl2N2O4 — CID 70535676
2-(3,4-dimethoxyphenyl)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-N,N,N'-trimethyl-2-propan-2-ylpentane-1,5-diamine;dihydrochloride (PubChem CID 70535676) has the molecular formula C29H48Cl2N2O4 and a molecular weight of 559.62 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-N,N,N'-trimethyl-2-propan-2-ylpentane-1,5-diamine;dihydrochloride.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-N,N,N'-trimethyl-2-propan-2-ylpentane-1,5-diamine;dihydrochloride |
|---|---|
| PubChem CID | 70535676 |
| Molecular Formula | C29H48Cl2N2O4 |
| Molecular Weight | 559.62 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-N,N,N'-trimethyl-2-propan-2-ylpentane-1,5-diamine;dihydrochloride |
| SMILES | COc1ccc(CCN(C)CCCC(CN(C)C)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC.Cl.Cl |
| InChI | InChI=1S/C29H46N2O4.2ClH/c1-22(2)29(21-30(3)4,24-12-14-26(33-7)28(20-24)35-9)16-10-17-31(5)18-15-23-11-13-25(32-6)27(19-23)34-8;;/h11-14,19-20,22H,10,15-18,21H2,1-9H3;2*1H |
| InChIKey | GAASQWYTJYOQDS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.62 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |