C36H57N3O4 — CID 46886428
2-(3,4-dimethoxyphenyl)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methyl-2-propan-2-yl-N-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methyl]pentane-1,5-diamine (PubChem CID 46886428) has the molecular formula C36H57N3O4 and a molecular weight of 595.87 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methyl-2-propan-2-yl-N-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methyl]pentane-1,5-diamine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methyl-2-propan-2-yl-N-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 46886428 |
| Molecular Formula | C36H57N3O4 |
| Molecular Weight | 595.87 g/mol |
| Exact Mass | 595.43 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methyl-2-propan-2-yl-N-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methyl]pentane-1,5-diamine |
| SMILES | COc1ccc(CCN(C)CCCC(CNCC2=CC(C)(C)NC2(C)C)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC |
| InChI | InChI=1S/C36H57N3O4/c1-26(2)36(28-14-16-31(41-9)33(22-28)43-11,25-37-24-29-23-34(3,4)38-35(29,5)6)18-12-19-39(7)20-17-27-13-15-30(40-8)32(21-27)42-10/h13-16,21-23,26,37-38H,12,17-20,24-25H2,1-11H3 |
| InChIKey | PMHUNWICIAERSX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.87 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|