C37H57N3O6 — CID 46886422
N-[2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentyl]-1-hydroxy-2,2,4,5,5-pentamethylpyrrole-3-carboxamide (PubChem CID 46886422) has the molecular formula C37H57N3O6 and a molecular weight of 639.88 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentyl]-1-hydroxy-2,2,4,5,5-pentamethylpyrrole-3-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentyl]-1-hydroxy-2,2,4,5,5-pentamethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 46886422 |
| Molecular Formula | C37H57N3O6 |
| Molecular Weight | 639.88 g/mol |
| Exact Mass | 639.42 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentyl]-1-hydroxy-2,2,4,5,5-pentamethylpyrrole-3-carboxamide |
| SMILES | COc1ccc(CCN(C)CCCC(CNC(=O)C2=C(C)C(C)(C)N(O)C2(C)C)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC |
| InChI | InChI=1S/C37H57N3O6/c1-25(2)37(28-15-17-30(44-10)32(23-28)46-12,24-38-34(41)33-26(3)35(4,5)40(42)36(33,6)7)19-13-20-39(8)21-18-27-14-16-29(43-9)31(22-27)45-11/h14-17,22-23,25,42H,13,18-21,24H2,1-12H3,(H,38,41) |
| InChIKey | BADHBCVHOLJGHU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.88 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |