C27H37NO7 — CID 89223228
2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-(1-methoxyethenyl)pentanoic acid (PubChem CID 89223228) has the molecular formula C27H37NO7 and a molecular weight of 487.59 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-(1-methoxyethenyl)pentanoic acid.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-(1-methoxyethenyl)pentanoic acid |
|---|---|
| PubChem CID | 89223228 |
| Molecular Formula | C27H37NO7 |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-(1-methoxyethenyl)pentanoic acid |
| SMILES | C=C(OC)C(CCCN(C)CCc1ccc(OC)c(OC)c1)(C(=O)O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C27H37NO7/c1-19(31-3)27(26(29)30,21-10-12-23(33-5)25(18-21)35-7)14-8-15-28(2)16-13-20-9-11-22(32-4)24(17-20)34-6/h9-12,17-18H,1,8,13-16H2,2-7H3,(H,29,30) |
| InChIKey | HXNWENFIFGMJMV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|