C14H23NO2S — CID 115225219
3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propane-1-thiol (PubChem CID 115225219) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propane-1-thiol.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propane-1-thiol |
|---|---|
| PubChem CID | 115225219 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propane-1-thiol |
| SMILES | COc1ccc(CCN(C)CCCS)cc1OC |
| InChI | InChI=1S/C14H23NO2S/c1-15(8-4-10-18)9-7-12-5-6-13(16-2)14(11-12)17-3/h5-6,11,18H,4,7-10H2,1-3H3 |
| InChIKey | QLSDHAUBULHIHD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|