C30H48N2O5 — CID 13195716
N'-[2-(3,4-dimethoxyphenyl)ethyl]-N,N,N'-trimethyl-2-propan-2-yl-2-(3,4,5-trimethoxyphenyl)pentane-1,5-diamine (PubChem CID 13195716) has the molecular formula C30H48N2O5 and a molecular weight of 516.72 g/mol. Its IUPAC name is N'-[2-(3,4-dimethoxyphenyl)ethyl]-N,N,N'-trimethyl-2-propan-2-yl-2-(3,4,5-trimethoxyphenyl)pentane-1,5-diamine.
| Compound Name | N'-[2-(3,4-dimethoxyphenyl)ethyl]-N,N,N'-trimethyl-2-propan-2-yl-2-(3,4,5-trimethoxyphenyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 13195716 |
| Molecular Formula | C30H48N2O5 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.36 |
| IUPAC Name | N'-[2-(3,4-dimethoxyphenyl)ethyl]-N,N,N'-trimethyl-2-propan-2-yl-2-(3,4,5-trimethoxyphenyl)pentane-1,5-diamine |
| SMILES | COc1ccc(CCN(C)CCCC(CN(C)C)(c2cc(OC)c(OC)c(OC)c2)C(C)C)cc1OC |
| InChI | InChI=1S/C30H48N2O5/c1-22(2)30(21-31(3)4,24-19-27(35-8)29(37-10)28(20-24)36-9)15-11-16-32(5)17-14-23-12-13-25(33-6)26(18-23)34-7/h12-13,18-20,22H,11,14-17,21H2,1-10H3 |
| InChIKey | HLQNOKMQRAULFA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |