C17H24N2O4 — CID 163987712
ethyl N-[2-cyano-2-(3,4-dimethoxyphenyl)-3-methylbutyl]carbamate (PubChem CID 163987712) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is ethyl N-[2-cyano-2-(3,4-dimethoxyphenyl)-3-methylbutyl]carbamate.
| Compound Name | ethyl N-[2-cyano-2-(3,4-dimethoxyphenyl)-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 163987712 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | ethyl N-[2-cyano-2-(3,4-dimethoxyphenyl)-3-methylbutyl]carbamate |
| SMILES | CCOC(=O)NCC(C#N)(c1ccc(OC)c(OC)c1)C(C)C |
| InChI | InChI=1S/C17H24N2O4/c1-6-23-16(20)19-11-17(10-18,12(2)3)13-7-8-14(21-4)15(9-13)22-5/h7-9,12H,6,11H2,1-5H3,(H,19,20) |
| InChIKey | TXUOXVHLFWKADM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |