C31H44N2O6 — CID 70442204
tert-butyl N-[(2S)-6-cyano-1,6-bis(3,4-dimethoxyphenyl)-7-methyloctan-2-yl]carbamate (PubChem CID 70442204) has the molecular formula C31H44N2O6 and a molecular weight of 540.70 g/mol. Its IUPAC name is tert-butyl N-[(2S)-6-cyano-1,6-bis(3,4-dimethoxyphenyl)-7-methyloctan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-6-cyano-1,6-bis(3,4-dimethoxyphenyl)-7-methyloctan-2-yl]carbamate |
|---|---|
| PubChem CID | 70442204 |
| Molecular Formula | C31H44N2O6 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | tert-butyl N-[(2S)-6-cyano-1,6-bis(3,4-dimethoxyphenyl)-7-methyloctan-2-yl]carbamate |
| SMILES | COc1ccc(C[C@H](CCCC(C#N)(c2ccc(OC)c(OC)c2)C(C)C)NC(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C31H44N2O6/c1-21(2)31(20-32,23-13-15-26(36-7)28(19-23)38-9)16-10-11-24(33-29(34)39-30(3,4)5)17-22-12-14-25(35-6)27(18-22)37-8/h12-15,18-19,21,24H,10-11,16-17H2,1-9H3,(H,33,34)/t24-,31?/m0/s1 |
| InChIKey | UGYRMVSYIUOZIR-ACXKHFGCSA-N |
| XLogP | 6.44 |
| TPSA | 99.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |