C27H38N2O3 — CID 70440530
(2S)-5-[3-(3,4-dimethoxyphenyl)propylamino]-2-(3-ethoxyphenyl)-2-propan-2-ylpentanenitrile (PubChem CID 70440530) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is (2S)-5-[3-(3,4-dimethoxyphenyl)propylamino]-2-(3-ethoxyphenyl)-2-propan-2-ylpentanenitrile.
| Compound Name | (2S)-5-[3-(3,4-dimethoxyphenyl)propylamino]-2-(3-ethoxyphenyl)-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 70440530 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | (2S)-5-[3-(3,4-dimethoxyphenyl)propylamino]-2-(3-ethoxyphenyl)-2-propan-2-ylpentanenitrile |
| SMILES | CCOc1cccc([C@](C#N)(CCCNCCCc2ccc(OC)c(OC)c2)C(C)C)c1 |
| InChI | InChI=1S/C27H38N2O3/c1-6-32-24-12-7-11-23(19-24)27(20-28,21(2)3)15-9-17-29-16-8-10-22-13-14-25(30-4)26(18-22)31-5/h7,11-14,18-19,21,29H,6,8-10,15-17H2,1-5H3/t27-/m0/s1 |
| InChIKey | ZOOGUUNBBXLDFG-MHZLTWQESA-N |
| XLogP | 5.52 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|