C28H40N2O2 — CID 19038594
2-(3,4-dimethoxyphenyl)-5-(2-phenylhexylamino)-2-propan-2-ylpentanenitrile (PubChem CID 19038594) has the molecular formula C28H40N2O2 and a molecular weight of 436.64 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-(2-phenylhexylamino)-2-propan-2-ylpentanenitrile.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-(2-phenylhexylamino)-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 19038594 |
| Molecular Formula | C28H40N2O2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-(2-phenylhexylamino)-2-propan-2-ylpentanenitrile |
| SMILES | CCCCC(CNCCCC(C#N)(c1ccc(OC)c(OC)c1)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H40N2O2/c1-6-7-12-24(23-13-9-8-10-14-23)20-30-18-11-17-28(21-29,22(2)3)25-15-16-26(31-4)27(19-25)32-5/h8-10,13-16,19,22,24,30H,6-7,11-12,17-18,20H2,1-5H3 |
| InChIKey | DVKJNRXMODMUMG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|