C30H37N3O6 — CID 45046950
(E)-but-2-enedioic acid;2-(3,4-dimethoxyphenyl)-5-[2-(1H-indol-3-yl)ethylamino]-2-propan-2-ylpentanenitrile (PubChem CID 45046950) has the molecular formula C30H37N3O6 and a molecular weight of 535.64 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(3,4-dimethoxyphenyl)-5-[2-(1H-indol-3-yl)ethylamino]-2-propan-2-ylpentanenitrile.
| Compound Name | (E)-but-2-enedioic acid;2-(3,4-dimethoxyphenyl)-5-[2-(1H-indol-3-yl)ethylamino]-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 45046950 |
| Molecular Formula | C30H37N3O6 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(3,4-dimethoxyphenyl)-5-[2-(1H-indol-3-yl)ethylamino]-2-propan-2-ylpentanenitrile |
| SMILES | COc1ccc(C(C#N)(CCCNCCc2c[nH]c3ccccc23)C(C)C)cc1OC.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C26H33N3O2.C4H4O4/c1-19(2)26(18-27,21-10-11-24(30-3)25(16-21)31-4)13-7-14-28-15-12-20-17-29-23-9-6-5-8-22(20)23;5-3(6)1-2-4(7)8/h5-6,8-11,16-17,19,28-29H,7,12-15H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | GTGKIJTXVRVYIS-WLHGVMLRSA-N |
| XLogP | 4.93 |
| TPSA | 144.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|