C22H22N2O4 — CID 11530966
[4-[(E)-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate (PubChem CID 11530966) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is [4-[(E)-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(E)-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 11530966 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [4-[(E)-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=C/C(=O)NCCc2c[nH]c3ccccc23)ccc1OC(C)=O |
| InChI | InChI=1S/C22H22N2O4/c1-15(25)28-20-9-7-16(13-21(20)27-2)8-10-22(26)23-12-11-17-14-24-19-6-4-3-5-18(17)19/h3-10,13-14,24H,11-12H2,1-2H3,(H,23,26)/b10-8+ |
| InChIKey | TUQBLQVSUASTCI-CSKARUKUSA-N |
| XLogP | 3.47 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|