C16H18N2O — CID 47101909
(2E,4E)-N-[2-(1H-indol-3-yl)ethyl]hexa-2,4-dienamide (PubChem CID 47101909) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is (2E,4E)-N-[2-(1H-indol-3-yl)ethyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[2-(1H-indol-3-yl)ethyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 47101909 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (2E,4E)-N-[2-(1H-indol-3-yl)ethyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H18N2O/c1-2-3-4-9-16(19)17-11-10-13-12-18-15-8-6-5-7-14(13)15/h2-9,12,18H,10-11H2,1H3,(H,17,19)/b3-2+,9-4+ |
| InChIKey | RHHFEABJCTXYBG-DSXPNFDZSA-N |
| XLogP | 2.96 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|