C20H17N3O2 — CID 17426636
(E)-3-(1,3-benzoxazol-2-yl)-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide (PubChem CID 17426636) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 17426636 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2o1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H17N3O2/c24-19(9-10-20-23-17-7-3-4-8-18(17)25-20)21-12-11-14-13-22-16-6-2-1-5-15(14)16/h1-10,13,22H,11-12H2,(H,21,24)/b10-9+ |
| InChIKey | ZVKGSQHGORCYLA-MDZDMXLPSA-N |
| XLogP | 3.68 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|