C27H36N2O6 — CID 141227681
methyl 3-[2-[[5-cyano-5-(3,4-dimethoxyphenyl)-6-ethoxy-6-hydroxyhexyl]amino]ethyl]benzoate (PubChem CID 141227681) has the molecular formula C27H36N2O6 and a molecular weight of 484.59 g/mol. Its IUPAC name is methyl 3-[2-[[5-cyano-5-(3,4-dimethoxyphenyl)-6-ethoxy-6-hydroxyhexyl]amino]ethyl]benzoate.
| Compound Name | methyl 3-[2-[[5-cyano-5-(3,4-dimethoxyphenyl)-6-ethoxy-6-hydroxyhexyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 141227681 |
| Molecular Formula | C27H36N2O6 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | methyl 3-[2-[[5-cyano-5-(3,4-dimethoxyphenyl)-6-ethoxy-6-hydroxyhexyl]amino]ethyl]benzoate |
| SMILES | CCOC(O)C(C#N)(CCCCNCCc1cccc(C(=O)OC)c1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C27H36N2O6/c1-5-35-26(31)27(19-28,22-11-12-23(32-2)24(18-22)33-3)14-6-7-15-29-16-13-20-9-8-10-21(17-20)25(30)34-4/h8-12,17-18,26,29,31H,5-7,13-16H2,1-4H3 |
| InChIKey | FFAMLGCAIUAWHA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 110.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|