C32H47N3O5 — CID 18426340
N-tert-butyl-2-[2-[[5-cyano-5-(3,4-dimethoxyphenyl)-6-methylheptyl]amino]ethyl]-4,5-dimethoxybenzamide (PubChem CID 18426340) has the molecular formula C32H47N3O5 and a molecular weight of 553.74 g/mol. Its IUPAC name is N-tert-butyl-2-[2-[[5-cyano-5-(3,4-dimethoxyphenyl)-6-methylheptyl]amino]ethyl]-4,5-dimethoxybenzamide.
| Compound Name | N-tert-butyl-2-[2-[[5-cyano-5-(3,4-dimethoxyphenyl)-6-methylheptyl]amino]ethyl]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 18426340 |
| Molecular Formula | C32H47N3O5 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.35 |
| IUPAC Name | N-tert-butyl-2-[2-[[5-cyano-5-(3,4-dimethoxyphenyl)-6-methylheptyl]amino]ethyl]-4,5-dimethoxybenzamide |
| SMILES | COc1ccc(C(C#N)(CCCCNCCc2cc(OC)c(OC)cc2C(=O)NC(C)(C)C)C(C)C)cc1OC |
| InChI | InChI=1S/C32H47N3O5/c1-22(2)32(21-33,24-12-13-26(37-6)28(19-24)39-8)15-10-11-16-34-17-14-23-18-27(38-7)29(40-9)20-25(23)30(36)35-31(3,4)5/h12-13,18-20,22,34H,10-11,14-17H2,1-9H3,(H,35,36) |
| InChIKey | OAXGTHHEFWMTFR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|