C26H35FN2O4 — CID 90251643
(2S)-2-(3,4-dimethoxyphenyl)-5-[2-[4-(2-fluoroethoxy)-3-hydroxyphenyl]ethylamino]-2-propan-2-ylpentanenitrile (PubChem CID 90251643) has the molecular formula C26H35FN2O4 and a molecular weight of 458.57 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethoxyphenyl)-5-[2-[4-(2-fluoroethoxy)-3-hydroxyphenyl]ethylamino]-2-propan-2-ylpentanenitrile.
| Compound Name | (2S)-2-(3,4-dimethoxyphenyl)-5-[2-[4-(2-fluoroethoxy)-3-hydroxyphenyl]ethylamino]-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 90251643 |
| Molecular Formula | C26H35FN2O4 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | (2S)-2-(3,4-dimethoxyphenyl)-5-[2-[4-(2-fluoroethoxy)-3-hydroxyphenyl]ethylamino]-2-propan-2-ylpentanenitrile |
| SMILES | COc1ccc([C@](C#N)(CCCNCCc2ccc(OCCF)c(O)c2)C(C)C)cc1OC |
| InChI | InChI=1S/C26H35FN2O4/c1-19(2)26(18-28,21-7-9-24(31-3)25(17-21)32-4)11-5-13-29-14-10-20-6-8-23(22(30)16-20)33-15-12-27/h6-9,16-17,19,29-30H,5,10-15H2,1-4H3/t26-/m0/s1 |
| InChIKey | OGBQQMROVOQMPU-SANMLTNESA-N |
| XLogP | 4.79 |
| TPSA | 83.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|