C16H20BrNO2 — CID 59419923
methyl 3-(6-bromo-3-cyano-2-methylhexan-3-yl)benzoate (PubChem CID 59419923) has the molecular formula C16H20BrNO2 and a molecular weight of 338.25 g/mol. Its IUPAC name is methyl 3-(6-bromo-3-cyano-2-methylhexan-3-yl)benzoate.
| Compound Name | methyl 3-(6-bromo-3-cyano-2-methylhexan-3-yl)benzoate |
|---|---|
| PubChem CID | 59419923 |
| Molecular Formula | C16H20BrNO2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | methyl 3-(6-bromo-3-cyano-2-methylhexan-3-yl)benzoate |
| SMILES | COC(=O)c1cccc(C(C#N)(CCCBr)C(C)C)c1 |
| InChI | InChI=1S/C16H20BrNO2/c1-12(2)16(11-18,8-5-9-17)14-7-4-6-13(10-14)15(19)20-3/h4,6-7,10,12H,5,8-9H2,1-3H3 |
| InChIKey | RSYJWBDTRKBRAT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|