C29H40N2O5 — CID 25131314
2-methoxyethyl 3-[2-[[4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]ethyl]benzoate (PubChem CID 25131314) has the molecular formula C29H40N2O5 and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-methoxyethyl 3-[2-[[4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]ethyl]benzoate.
| Compound Name | 2-methoxyethyl 3-[2-[[4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]ethyl]benzoate |
|---|---|
| PubChem CID | 25131314 |
| Molecular Formula | C29H40N2O5 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | 2-methoxyethyl 3-[2-[[4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]ethyl]benzoate |
| SMILES | COCCOC(=O)c1cccc(CCN(C)CCCC(C#N)(c2ccc(OC)c(OC)c2)C(C)C)c1 |
| InChI | InChI=1S/C29H40N2O5/c1-22(2)29(21-30,25-11-12-26(34-5)27(20-25)35-6)14-8-15-31(3)16-13-23-9-7-10-24(19-23)28(32)36-18-17-33-4/h7,9-12,19-20,22H,8,13-18H2,1-6H3 |
| InChIKey | JJWFDCXRIVWNGF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|